Q9Y5S2 | MRCKB_HUMAN | Serine/threonine-protein kinase MRCK beta (CDC42BPB)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00069 | Pkinase - Protein kinase domain | 76~341 | |
| PF00130 | C1_1 - Phorbol esters/diacylglycerol binding domain (C1 domain) | 1026~1076 | |
| PF00780 | CNH - CNH domain | 1251~1509 | |
| PF08826 | DMPK_coil - DMPK coiled coil domain like | 878~939 | |
| PF15796 | KELK - KELK-motif containing domain of MRCK Ser/Thr protein kinase | 528~606 | |
| PF25346 | PH_MRCK - MRCK kinase PH domain | 1089~1215 |
3D structures mapped by conservation among orthologs
[ Domain: "Protein kinase" // Pkinase_Tyr ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 4.75 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328509 | single protein format |
| CHEMBL103667 |  |
IC50 | < | 1000.0 | nM | 527.67 | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)cc1 | Homo sapiens | CHEMBL4602929 | single protein format |