Q9UNA4 | POLI_HUMAN | DNA polymerase iota (POLI)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00817 | IMS - impB/mucB/samB family | 58~235 | |
| PF11799 | IMS_C - impB/mucB/samB family C-terminal domain | 324~439 | |
| PF14377 | UBM - Ubiquitin binding region | 521~551 | |
| PF14377 | UBM - Ubiquitin binding region | 701~731 | |
| PF21999 | IMS_HHH_1 - DNA polymerase-iota, thumb domain | 262~314 |
3D structures mapped by conservation among orthologs
[ Domain: "SAM domain-like" // IMS_HHH_2 ]
[ Domain: "Lesion bypass DNA polymerase (Y-family), little finger domain" // IMS_C ]
[ Domain: "Adenylyl and guanylyl cyclase catalytic domain-like" // IMS ]
[ Domain: "Hypothetical protein Ta1206-like" // IMS_1 ]
[ Domain: "Ubiquitin-binding motif (UBM)" // DUF4414 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL6246 |  |
IC50 | = | 62.0 | nM | 302.19 | O=c1oc2c(O)c(O)cc3c(=O)oc4c(O)c(O)cc1c4c23 | Homo sapiens | CHEMBL3854638 | assay format |
| CHEMBL275938 |  |
IC50 | = | 75.0 | nM | 422.35 | O=C(O)C1=CC(=C(c2ccc(O)c(C(=O)O)c2)c2ccc(O)c(C(=O)O)c2)C=CC1=O | Homo sapiens | CHEMBL3854638 | assay format |