Q9UNA4 | POLI_HUMAN | DNA polymerase iota (POLI)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00817 | IMS | 58–235 | |
PF11799 | IMS_C | 324–439 | |
PF14377 | UBM | 521–551 | |
PF14377 | UBM | 701–731 | |
PF21999 | IMS_HHH_1 | 262–314 |
3D structures mapped by conservation among orthologs
[ Domain: "SAM domain-like" // IMS_HHH_2 ]
[ Domain: "Lesion bypass DNA polymerase (Y-family), little finger domain" // IMS_C ]
[ Domain: "Adenylyl and guanylyl cyclase catalytic domain-like" // IMS ]
[ Domain: "Hypothetical protein Ta1206-like" // IMS_1 ]
[ Domain: "Ubiquitin-binding motif (UBM)" // DUF4414 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL6246 | IC50 | = | 62.0 | nM | 302.19 | O=c1oc2c(O)c(O)cc3c(=O)oc4c(O)c(O)cc1c4c23 | Homo sapiens | CHEMBL3854638 | assay format | |
CHEMBL275938 | IC50 | = | 75.0 | nM | 422.35 | O=C(O)C1=CC(=C(c2ccc(O)c(C(=O)O)c2)c2ccc(O)c(C(=O)O)c2)C=CC1=O | Homo sapiens | CHEMBL3854638 | assay format |