Q9ULC6 | PADI1_HUMAN | Protein-arginine deiminase type-1 (PADI1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF03068 | PAD - Protein-arginine deiminase (PAD) | 282~660 | |
| PF08526 | PAD_N - Protein-arginine deiminase (PAD) N-terminal domain | 1~113 | |
| PF08527 | PAD_M - Protein-arginine deiminase (PAD) middle domain | 115~273 |
3D structures mapped by conservation among orthologs
[ Domain: "Common fold of diphtheria toxin/transcription factors/cytochrome f" // PAD_M ]
[ Domain: "Cupredoxin-related" // PAD_N ]
[ Domain: "Pentein" // PAD,PAD_M ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL58150 |  |
IC50 | = | 70.0 | nM | 295.25 | NC1=CC(=O)c2ccc(-c3cccc(C(=O)O)n3)nc2C1=O | Homo sapiens | CHEMBL3119095 | single protein format |
| CHEMBL1910972 |  |
IC50 | = | 800.0 | nM | 424.81 | N=C(CCl)NCCC[C@H](NC(=O)c1ccccc1)C(N)=O.O=C(O)C(F)(F)F | Homo sapiens | CHEMBL1914012 | single protein format |
| CHEMBL1910971 |  |
IC50 | = | 840.0 | nM | 468.82 | N=C(CCl)NCCC[C@H](NC(=O)c1ccccc1C(=O)O)C(N)=O.O=C(O)C(F)(F)F | Homo sapiens | CHEMBL1914012 | single protein format |
| CHEMBL57818 |  |
IC50 | = | 950.0 | nM | 251.25 | NC1=CC(=O)c2ccc(-c3ccccn3)nc2C1=O | Homo sapiens | CHEMBL3119095 | single protein format |
| CHEMBL60908 |  |
IC50 | = | 960.0 | nM | 174.16 | NC1=CC(=O)c2cccnc2C1=O | Homo sapiens | CHEMBL3119095 | single protein format |