Q9UIF9 | BAZ2A_HUMAN | Bromodomain adjacent to zinc finger domain protein 2A (BAZ2A)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00439 | Bromodomain - Bromodomain | 1802~1883 | |
| PF00628 | PHD - PHD-finger | 1679~1723 | |
| PF01429 | MBD - Methyl-CpG binding domain | 547~619 | |
| PF02791 | DDT - DDT domain | 850~910 | |
| PF15612 | WHIM1 - WSTF, HB1, Itc1p, MBD9 motif 1 | 952~993 | |
| PF15613 | WSD - Williams-Beuren syndrome DDT (WSD), D-TOX E motif | 1112~1472 |
3D structures mapped by conservation among orthologs
[ Domain: "Bromodomain" // Bromodomain ]
[ Domain: "Methyl-CpG-binding domain, MBD" // MBD ]
[ Domain: "FYVE/PHD zinc finger" // PHD_1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4296718 |  |
IC50 | = | 130.0 | nM | 357.42 | Cn1cc(CCn2cnc(-c3cnn(C)c3)c2-c2ccc(C#N)cc2)cn1 | Homo sapiens | CHEMBL3419224 | single protein format |
| CHEMBL3770199 |  |
IC50 | = | 160.0 | nM | 442.54 | CC(=O)c1cc(-c2ccccc2S(C)(=O)=O)c2cc(CNC(=O)OC(C)(C)C)ccn12 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL3739699 |  |
IC50 | = | 400.0 | nM | 371.46 | CCCOc1ccn2c(C(C)=O)cc(-c3ccccc3S(C)(=O)=O)c2c1 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL3415185 |  |
IC50 | = | 450.0 | nM | 362.37 | Cc1cn(Cn2cnc(-c3cnn(C)c3)c2-c2ccc(C#N)c(F)c2)nn1 | Homo sapiens | CHEMBL3419224 | single protein format |
| CHEMBL3770277 |  |
IC50 | = | 550.0 | nM | 405.48 | CC(=O)c1cc(-c2ccccc2S(C)(=O)=O)c2cc(Oc3ccccc3)ccn12 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL3770214 |  |
IC50 | = | 580.0 | nM | 343.4 | COc1ccn2c(C(C)=O)cc(-c3ccccc3S(C)(=O)=O)c2c1 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL3415182 |  |
IC50 | = | 600.0 | nM | 358.41 | Cc1cn(CCn2cnc(-c3cnn(C)c3)c2-c2ccc(C#N)cc2)nn1 | Homo sapiens | CHEMBL3419224 | single protein format |
| CHEMBL3770847 |  |
IC50 | = | 720.0 | nM | 313.38 | CC(=O)c1cc(-c2ccccc2S(C)(=O)=O)c2ccccn12 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL4436408 |  |
IC50 | = | 880.0 | nM | 295.34 | CN(C)C(=O)c1cccc(-c2cn(C)c(=O)c3[nH]ccc23)c1 | Homo sapiens | CHEMBL4425869 | assay format |
| CHEMBL3770738 |  |
IC50 | = | 890.0 | nM | 327.41 | CC(=O)c1cc(-c2ccccc2S(C)(=O)=O)c2cc(C)ccn12 | Homo sapiens | CHEMBL3772735 | assay format |
| CHEMBL3771216 |  |
IC50 | = | 1000.0 | nM | 279.34 | CC(=O)c1cc(-c2ccccc2CO)c2cc(C)ccn12 | Homo sapiens | CHEMBL3772735 | assay format |