Q9UHI8 | ATS1_HUMAN | A disintegrin and metalloproteinase with thrombospondin motifs 1 (ADAMTS1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00090 | TSP_1 | 564–613 | |
PF01421 | Reprolysin | 258–467 | |
PF01562 | Pep_M12B_propep | 71–130 | |
PF05986 | ADAMTS_spacer1 | 727–842 | |
PF17771 | ADAMTS_CR_2 | 478–546 | |
PF19030 | TSP1_ADAMTS | 858–909 | |
PF19030 | TSP1_ADAMTS | 912–966 | |
PF19236 | ADAMTS_CR_3 | 644–724 |
3D structures mapped by conservation among orthologs
[ Domain: "Metalloproteases ("zincins") catalytic domain" // Reprolysin ]
[ Domain: "Disulfide-rich domain in A Disintegrin And Metalloprotease (ADAM) domain-containing proteins" // KOG3538_1st ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL187092 | IC50 | = | 79.0 | nM | 472.92 | C[C@@]1(O)CCCN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3Cl)cc2)[C@H]1C(=O)NO | Homo sapiens | CHEMBL2167995 | single protein format | |
CHEMBL4877087 | IC50 | = | 328.0 | nM | 390.87 | O=C1NC(=O)C(CCC(=O)N2CCN(c3cccc(Cl)c3)CC2)(C2CC2)N1 | Homo sapiens | CHEMBL4835174 | single protein format | |
CHEMBL4862188 | IC50 | = | 631.0 | nM | 445.88 | O=C1NC(=O)C(CCC(=O)N2CCN(c3ccc(F)c(Cl)c3)CC2)(c2ccccn2)N1 | Homo sapiens | CHEMBL4835174 | single protein format | |
CHEMBL208009 | Ki | = | 776.0 | nM | 448.52 | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCNCC3)cc2)c2ccccc2n1 | Homo sapiens | CHEMBL853110 | single protein format |