Q9UHI8 | ATS1_HUMAN | A disintegrin and metalloproteinase with thrombospondin motifs 1 (ADAMTS1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00090 | TSP_1 - Thrombospondin type 1 domain | 564~613 | |
| PF01421 | Reprolysin - Reprolysin (M12B) family zinc metalloprotease | 258~467 | |
| PF01562 | Pep_M12B_propep - Reprolysin family propeptide | 71~130 | |
| PF05986 | ADAMTS_spacer1 - ADAM-TS Spacer 1 | 727~842 | |
| PF17771 | ADAMTS_CR_2 - ADAMTS cysteine-rich domain 2 | 478~546 | |
| PF19030 | TSP1_ADAMTS - Thrombospondin type 1 domain | 858~909 | |
| PF19030 | TSP1_ADAMTS - Thrombospondin type 1 domain | 912~966 | |
| PF19236 | ADAMTS_CR_3 - ADAMTS cysteine-rich domain | 644~724 |
3D structures mapped by conservation among orthologs
[ Domain: "Metalloproteases ("zincins") catalytic domain" // Reprolysin ]
[ Domain: "Disulfide-rich domain in A Disintegrin And Metalloprotease (ADAM) domain-containing proteins" // KOG3538_1st ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL187092 |  |
IC50 | = | 79.0 | nM | 472.92 | C[C@@]1(O)CCCN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3Cl)cc2)[C@H]1C(=O)NO | Homo sapiens | CHEMBL2167995 | single protein format |
| CHEMBL4877087 |  |
IC50 | = | 328.0 | nM | 390.87 | O=C1NC(=O)C(CCC(=O)N2CCN(c3cccc(Cl)c3)CC2)(C2CC2)N1 | Homo sapiens | CHEMBL4835174 | single protein format |
| CHEMBL4862188 |  |
IC50 | = | 631.0 | nM | 445.88 | O=C1NC(=O)C(CCC(=O)N2CCN(c3ccc(F)c(Cl)c3)CC2)(c2ccccn2)N1 | Homo sapiens | CHEMBL4835174 | single protein format |
| CHEMBL208009 |  |
Ki | = | 776.0 | nM | 448.52 | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCNCC3)cc2)c2ccccc2n1 | Homo sapiens | CHEMBL853110 | single protein format |