Q9UF33 | EPHA6_HUMAN | Ephrin type-A receptor 6 (EPHA6)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00041 | fn3 - Fibronectin type III domain | 333~427 | |
| PF00041 | fn3 - Fibronectin type III domain | 455~532 | |
| PF00536 | SAM_1 - SAM domain (Sterile alpha motif) | 965~1023 | |
| PF01404 | Ephrin_lbd - Ephrin receptor ligand binding domain | 35~207 | |
| PF07699 | Ephrin_rec_like - Tyrosine-protein kinase ephrin type A/B receptor-like | 272~312 | |
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 631~712 | |
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 744~930 | |
| PF14575 | EphA2_TM - Ephrin type-A receptor 2 transmembrane domain | 551~628 | |
| PF25599 | Ephrin_CRD - Ephrin cysteine rich domain | 208~265 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 11.8 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328401 | single protein format |
| CHEMBL3752910 |  |
IC50 | = | 263.0 | nM | 503.49 | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1Nc1nc(-c2cccnc2)nc2c1cnn2C | Homo sapiens | CHEMBL5212808 | assay format |