Q9UBB5 | MBD2_HUMAN | Methyl-CpG-binding domain protein 2 (MBD2)
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF01429 | MBD - Methyl-CpG binding domain | 148~214 | |
PF14048 | MBD_C - C-terminal domain of methyl-CpG binding protein 2 and 3 | 297~387 | |
PF16564 | MBDa - p55-binding region of Methyl-CpG-binding domain proteins MBD | 223~292 |
3D structures mapped by conservation among orthologs
[ Domain: "Methyl-CpG-binding domain, MBD" // MBD ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL3687963 | IC50 | = | 11.0 | nM | 256.33 | Oc1ccc(C2NN=C(c3ccccc3)S2)cc1 | Homo sapiens | CHEMBL3707490 | cell-based format | |
CHEMBL3687966 | IC50 | = | 210.0 | nM | 274.78 | Clc1ccc(C2NN=C(c3ccccc3)S2)cc1 | Homo sapiens | CHEMBL3707490 | cell-based format | |
CHEMBL3687965 | IC50 | = | 470.0 | nM | 350.37 | OC1(C(F)(F)F)CC(c2ccccc2)=NN1C(=S)c1ccccc1 | Homo sapiens | CHEMBL3707490 | cell-based format | |
CHEMBL520851 | IC50 | = | 670.0 | nM | 306.39 | Oc1ccc2ccccc2c1C1NN=C(c2ccccc2)S1 | Homo sapiens | CHEMBL3707490 | cell-based format |