Q9P2J5 | SYLC_HUMAN | Leucine--tRNA ligase, cytoplasmic (LARS1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00133 | tRNA-synt_1 - tRNA synthetases class I (I, L, M and V) | 20~103 | |
| PF00133 | tRNA-synt_1 - tRNA synthetases class I (I, L, M and V) | 188~755 | |
| PF08264 | Anticodon_1 - Anticodon-binding domain of tRNA ligase | 794~907 | |
| PF22947 | ULD_3 - Leucine--tRNA ligase, ubiquitin-like domain | 1064~1175 | |
| PF24810 | RBD_LARS1 - Leucine--tRNA ligase, RagD-binding domain | 940~1013 |
3D structures mapped by conservation among orthologs
[ Domain: "acid protease" // tRNA-synt_1_2 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL340082 |  |
IC50 | = | 1.6 | nM | 577.68 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccc(Oc4ccccc4)cc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL708592 | single protein format |
| CHEMBL421500 |  |
IC50 | = | 16.0 | nM | 489.55 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1(C(=O)O)[C@@H]2CN(C)C=C(C(N)=O)[C@@H]2C[C@@H]1O | Homo sapiens | CHEMBL708594 | single protein format |
| CHEMBL1163081 |  |
IC50 | = | 22.34 | nM | 459.49 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL4681668 | single protein format |
| CHEMBL4174152 |  |
IC50 | = | 33.0 | nM | 439.54 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)c1cccc(-c2cc(-c3ccccc3)nc(N)n2)c1 | Homo sapiens | CHEMBL4144832 | single protein format |
| CHEMBL4558130 |  |
IC50 | = | 70.04 | nM | 476.47 | CC(C)[C@@H](O)[C@H](O)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL4681668 | single protein format |
| CHEMBL4163450 |  |
IC50 | = | 160.0 | nM | 377.47 | Cc1cc(-c2cccc(S(=O)(=O)NC(=O)[C@@H](N)CC(C)C)c2)nc(N)n1 | Homo sapiens | CHEMBL4144832 | single protein format |
| CHEMBL4171458 |  |
IC50 | = | 220.0 | nM | 320.41 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 | Homo sapiens | CHEMBL4144832 | single protein format |
| CHEMBL4104169 |  |
IC50 | = | 337.1 | nM | 586.37 | CC(C)C[C@H](O)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(I)nc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL4681668 | single protein format |
| CHEMBL4172643 |  |
IC50 | = | 490.0 | nM | 362.46 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)c1cccc(-c2ccnc(N)c2)c1 | Homo sapiens | CHEMBL4144832 | single protein format |
| CHEMBL332104 |  |
IC50 | = | 730.0 | nM | 513.64 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(CCc3ccccc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL708598 | single protein format |
| CHEMBL4159778 |  |
IC50 | = | 850.0 | nM | 362.46 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)c1cccc(-c2cccc(N)n2)c1 | Homo sapiens | CHEMBL4144832 | single protein format |
| CHEMBL264002 |  |
IC50 | = | 1000.0 | nM | 485.58 | CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccccc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL708592 | single protein format |