Q9H7M9 | VISTA_HUMAN | V-type immunoglobulin domain-containing suppressor of T-cell activation (VSIR)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF07686 | V-set | 45–168 |
3D structures mapped by conservation among orthologs
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // I-set_7 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5197008 | IC50 | = | 17.0 | nM | 376.4 | CC(O)[C@H](NC(=O)N[C@@H](CC(N)=O)c1nnc([C@@H](N)CO)s1)C(=O)O | Homo sapiens | CHEMBL5096767 | single protein format | |
| CHEMBL5176557 | IC50 | = | 480.0 | nM | 393.54 | CCN(c1ccccc1)c1n/c(=N\Cc2ccc(-c3ccccc3)o2)ss1 | Homo sapiens | CHEMBL5111026 | single protein format |
