Q96S53 | TESK2_HUMAN | Dual specificity testis-specific protein kinase 2 (TESK2)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 62~308 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL2070615 |  |
IC50 | = | 252.0 | nM | 461.55 | CCNC(=O)Nc1ncc(-c2cc(-c3c(C)cc(OC)cc3C)nc(-c3cnccn3)n2)s1 | Homo sapiens | CHEMBL2071843 | single protein format |
| CHEMBL2070613 |  |
IC50 | = | 415.0 | nM | 503.63 | CCC(CC)Oc1cc(C)c(-c2cc(-c3cnc(NC(=O)NC)s3)nc(-c3cnccn3)n2)c(C)c1 | Homo sapiens | CHEMBL2071843 | single protein format |
| CHEMBL2070614 |  |
IC50 | = | 415.0 | nM | 447.52 | CNC(=O)Nc1ncc(-c2cc(-c3c(C)cc(OC)cc3C)nc(-c3cnccn3)n2)s1 | Homo sapiens | CHEMBL2071843 | single protein format |
| CHEMBL2070616 |  |
IC50 | = | 612.0 | nM | 432.51 | COc1cc(C)c(-c2cc(-c3cnc(NC(C)=O)s3)nc(-c3cnccn3)n2)c(C)c1 | Homo sapiens | CHEMBL2071843 | single protein format |