Q96Q04 | LMTK3_HUMAN | Serine/threonine-protein kinase LMTK3 (LMTK3)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 135~407 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 0.0024 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4620149 | single protein format |
| CHEMBL4637017 |  |
IC50 | = | 210.0 | nM | 465.02 | CC(C)C[C@H]1CNC(=N)N1C[C@H](Cc1ccc(O)cc1)NS(=O)(=O)c1ccccc1Cl | Homo sapiens | CHEMBL4620149 | single protein format |
| CHEMBL4647760 |  |
IC50 | = | 226.0 | nM | 505.08 | N=C1NC[C@H](CC2CCCCC2)N1C[C@H](Cc1ccc(O)cc1)NS(=O)(=O)c1ccccc1Cl | Homo sapiens | CHEMBL4620149 | single protein format |
| CHEMBL4635320 |  |
IC50 | = | 308.0 | nM | 444.6 | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(O)cc2)CN2C(=N)NC[C@@H]2CC(C)C)cc1 | Homo sapiens | CHEMBL4620149 | single protein format |
| CHEMBL4649625 |  |
IC50 | = | 318.0 | nM | 484.67 | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(O)cc2)CN2C(=N)NC[C@@H]2CC2CCCCC2)cc1 | Homo sapiens | CHEMBL4620149 | single protein format |
| CHEMBL4638119 |  |
IC50 | = | 654.0 | nM | 414.58 | CC(C)C[C@H]1CNC(=N)N1C[C@H](Cc1ccccc1)NS(=O)(=O)c1ccccc1 | Homo sapiens | CHEMBL4620149 | single protein format |