Q96P09 | BIRC8_HUMAN | Baculoviral IAP repeat-containing protein 8 (BIRC8)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00653 | BIR | 7–69 | |
| PF13920 | zf-C3HC4_3 | 185–227 | |
| PF21290 | UBA_BIRC2-3 | 112–157 |
3D structures mapped by conservation among orthologs
[ Domain: "Inhibitor of apoptosis (IAP) repeat" // BIR ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL481422 | Ki | = | 1.8 | nM | 476.62 | CN[C@@H](C)C(=O)N[C@H]1CCCC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format | |
| CHEMBL456400 | Ki | = | 1.9 | nM | 519.65 | CN[C@@H](C)C(=O)N[C@H]1CN(C(C)=O)CC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format | |
| CHEMBL504559 | Ki | = | 4.2 | nM | 595.74 | CN[C@@H](C)C(=O)N[C@H]1CN(C(=O)Cc2ccccc2)CC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format | |
| CHEMBL459541 | Ki | = | 4.6 | nM | 477.61 | CN[C@@H](C)C(=O)N[C@H]1CNCC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format | |
| CHEMBL506213 | Ki | = | 9.8 | nM | 567.73 | CN[C@@H](C)C(=O)N[C@H]1CN(Cc2ccccc2)CC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format | |
| CHEMBL461456 | Ki | = | 17.5 | nM | 491.64 | CN[C@@H](C)C(=O)N[C@H]1CN(C)CC[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O | Homo sapiens | CHEMBL985406 | cell-based format |
