Q96CA5 | BIRC7_HUMAN | Baculoviral IAP repeat-containing protein 7 (BIRC7)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00653 | BIR - Inhibitor of Apoptosis domain | 90~154 | |
| PF13920 | zf-C3HC4_3 - Zinc finger, C3HC4 type (RING finger) | 248~291 |
3D structures mapped by conservation among orthologs
[ Domain: "RING/U-box" // zf-C3HC4_3 ]
[ Domain: "Inhibitor of apoptosis (IAP) repeat" // BIR ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL2431768 |  |
IC50 | = | 9.0 | nM | 500.64 | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc(C(=O)c2ccc(F)cc2)cs1)C1CCCCC1 | Homo sapiens | CHEMBL5098727 | assay format |
| CHEMBL5186855 |  |
IC50 | = | 20.0 | nM | 431.54 | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(N)=O | Homo sapiens | CHEMBL5098727 | assay format |
| CHEMBL2063869 |  |
Ki | < | 50.0 | nM | 498.65 | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1snnc1-c1ccccc1)C1CCCCC1 | Homo sapiens | CHEMBL2066538 | single protein format |