Q969H4 | CNKR1_HUMAN | Connector enhancer of kinase suppressor of ras 1 (CNKSR1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00169 | PH | 406–501 | |
| PF10534 | CRIC_ras_sig | 78–160 |
3D structures mapped by conservation among orthologs
[ Domain: "SAM domain-like" // SAM_1_1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4285086 | IC50 | = | 1000.0 | nM | 369.42 | COc1c(/C=C/CO)c(NS(=O)(=O)c2cccs2)cc2c1OCO2 | Homo sapiens | CHEMBL4257055 | assay format | |
| CHEMBL4288751 | IC50 | = | 1000.0 | nM | 411.46 | CCOC(=O)/C=C/c1c(NS(=O)(=O)c2cccs2)cc2c(c1OC)OCO2 | Homo sapiens | CHEMBL4257055 | assay format |
