Q92570 | NR4A3_HUMAN | Nuclear receptor subfamily 4 group A member 3 (NR4A3)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00104 | Hormone_recep - Ligand-binding domain of nuclear hormone receptor | 434~606 | |
| PF00105 | zf-C4 - Double treble clef zinc finger, C4 type | 291~359 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4560385 |  |
IC50 | = | 1.2 | nM | 438.44 | N#CN1CCC[C@@H](n2nc(-c3ccc(Oc4ccc(F)cc4F)cc3)c(C(N)=O)c2N)C1 | Homo sapiens | CHEMBL5243497 | single protein format |
| CHEMBL5404368 |  |
IC50 | = | 18.0 | nM | 465.52 | C=CC(=O)N1CC[C@@H](N2N=C(Nc3ccc(Oc4ccccc4)cc3)c3c[nH]c4ncnc2c34)C1 | Homo sapiens | CHEMBL5355222 | single protein format |
| CHEMBL1873475 |  |
IC50 | = | 78.0 | nM | 440.51 | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 | Homo sapiens | CHEMBL4720218 | single protein format |
| CHEMBL4755698 |  |
IC50 | = | 210.6 | nM | 405.46 | C=CC(=O)N1CCC(Cn2cc(-c3ccc4c(c3)OCO4)c3c(N)ncnc32)CC1 | Homo sapiens | CHEMBL4720218 | single protein format |