Q8NFT8 | DNER_HUMAN | Delta and Notch-like epidermal growth factor-related receptor (DNER)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00008 | EGF | 98–131 | |
| PF00008 | EGF | 353–387 | |
| PF00008 | EGF | 399–425 | |
| PF00008 | EGF | 434–464 | |
| PF00008 | EGF | 472–501 | |
| PF00008 | EGF | 509–538 | |
| PF00008 | EGF | 585–614 | |
| PF12661 | hEGF | 552–573 | |
| PF19330 | DNER_C | 633–737 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1957266 | IC50 | = | 500.0 | nM | 457.0 | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 | Homo sapiens | CHEMBL5227235 | single protein format |
