Q8N5Y8 | PAR16_HUMAN | Protein mono-ADP-ribosyltransferase PARP16 (PARP16)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00644 | PARP - Poly(ADP-ribose) polymerase catalytic domain | 103~272 | |
| PF18084 | ARTD15_N - ARTD15 N-terminal domain | 13~90 |
3D structures mapped by conservation among orthologs
[ Domain: "Domain of poly(ADP-ribose) polymerase" // EUF08131 ]
[ Domain: "ADP-ribosylation" // PARP ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5284069 |  |
IC50 | = | 362.0 | nM | 323.18 | O=C1NCC(c2ccccn2)[C@@H](O)c2cc(Cl)c(Cl)cc21 | Homo sapiens | CHEMBL5240113 | single protein format |
| CHEMBL5189477 |  |
IC50 | = | 362.0 | nM | 323.18 | O=C1NC[C@@H](c2ccccn2)[C@@H](O)c2cc(Cl)c(Cl)cc21 | Homo sapiens | CHEMBL5124497 | single protein format |
| CHEMBL5172255 |  |
IC50 | = | 427.0 | nM | 373.01 | Nc1ncc2c(n1)CNC(=O)c1[nH]c(Br)c(Br)c1-2 | Homo sapiens | CHEMBL5124497 | single protein format |
| CHEMBL4089522 |  |
IC50 | = | 560.0 | nM | 396.42 | NC(=O)c1cccc(NC(=O)/C=C\C(=O)N2CCN(c3ccc(F)cc3)CC2)c1 | Homo sapiens | CHEMBL4022070 | single protein format |