Q8N543 | OGFD1_HUMAN | Prolyl 3-hydroxylase OGFOD1 (OGFOD1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF10637 | Ofd1_CTDD - Oxoglutarate and iron-dependent oxygenase degradation C-term | 262~538 | |
| PF13661 | 2OG-FeII_Oxy_4 - 2OG-Fe(II) oxygenase superfamily | 141~238 |
3D structures mapped by conservation among orthologs
[ Domain: "Double-stranded beta-helix" // Ofd1_CTDD ]
[ Domain: "Double-stranded beta-helix" // 2OG-FeII_Oxy_3 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3646118 |  |
IC50 | < | 1000.0 | nM | 314.31 | O=c1c(-n2ccnn2)c[nH]n1-c1cc(N2CCOCC2)ncn1 | Homo sapiens | CHEMBL4340711 | single protein format |
| CHEMBL2338329 |  |
IC50 | < | 1000.0 | nM | 352.35 | Cc1nc(C(=O)NCC(=O)O)c(O)c2ccc(Oc3ccccc3)cc12 | Homo sapiens | CHEMBL4340711 | single protein format |