Q8N371 | KDM8_HUMAN | Bifunctional peptidase and arginyl-hydroxylase JMJD5 (KDM8)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF13621 | Cupin_8 | 195–416 | |
| PF24472 | ARM_KDM8_N | 66–138 |
3D structures mapped by conservation among orthologs
[ Domain: "Double-stranded beta-helix" // JmjC_1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5419332 |  |
IC50 | = | 300.0 | nM | 314.34 | O=C(O)c1cc(C(=O)O)c(NCCCCc2ccccc2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5425339 |  |
IC50 | = | 400.0 | nM | 272.26 | O=C(O)c1cc(C(=O)O)c(NCc2ccccc2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5408048 |  |
IC50 | = | 400.0 | nM | 286.29 | CC(Nc1cnc(C(=O)O)cc1C(=O)O)c1ccccc1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5396670 |  |
IC50 | = | 400.0 | nM | 302.29 | COc1ccc(CNc2cnc(C(=O)O)cc2C(=O)O)cc1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5407378 |  |
IC50 | = | 500.0 | nM | 340.26 | O=C(O)c1cc(C(=O)O)c(NCc2ccc(C(F)(F)F)cc2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL316034 |  |
IC50 | = | 500.0 | nM | 167.12 | O=C(O)c1ccnc(C(=O)O)c1 | Homo sapiens | CHEMBL5364257 | single protein format |
| CHEMBL5428941 |  |
IC50 | = | 700.0 | nM | 302.29 | COc1ccccc1CNc1cnc(C(=O)O)cc1C(=O)O | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5423565 |  |
IC50 | = | 700.0 | nM | 278.31 | O=C(O)c1cc(C(=O)O)c(NCC2CCCCC2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5408058 |  |
IC50 | = | 700.0 | nM | 312.33 | O=C(O)c1cc(C(=O)O)c(NCc2ccccc2C2CC2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |
| CHEMBL5402035 |  |
IC50 | = | 900.0 | nM | 300.31 | O=C(O)c1cc(C(=O)O)c(NCCCc2ccccc2)cn1 | Homo sapiens | CHEMBL5364256 | assay format |