Q8IZX4 | TAF1L_HUMAN | Transcription initiation factor TFIID subunit 1-like (TAF1L)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00439 | Bromodomain - Bromodomain | 1409~1489 | |
| PF00439 | Bromodomain - Bromodomain | 1535~1614 | |
| PF09247 | TBP-binding - TATA box-binding protein binding | 23~85 | |
| PF12157 | DUF3591 - Protein of unknown function (DUF3591) | 584~1046 | |
| PF15288 | zf-CCHC_6 - Zinc knuckle | 1280~1321 |
3D structures mapped by conservation among orthologs
[ Domain: "Bromodomain" // Bromodomain ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5426285 |  |
IC50 | = | 0.6 | nM | 358.47 | COC[C@@H](CC(C)C)NC1=N/C(=C\c2ccc3ncsc3c2)C(=O)N1 | Homo sapiens | CHEMBL5378521 | single protein format |
| CHEMBL4086276 |  |
IC50 | = | 106.0 | nM | 429.48 | Cc1cc2c(cc1N1C(=O)c3cccc4c(CCCO)ccc(c34)C1=O)n(C)c(=O)n2C | Homo sapiens | CHEMBL4051535 | assay format |
| CHEMBL5190023 |  |
IC50 | = | 124.0 | nM | 527.45 | CNC(=O)[C@]1(C)CC[C@@H](Nc2ncc3c(Br)nn(-c4ccc(-c5nnc(C)s5)cc4)c3n2)C1 | Homo sapiens | CHEMBL5111597 | single protein format |