Q86VL8 | S47A2_HUMAN | Multidrug and toxin extrusion protein 2 (SLC47A2)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF01554 | MatE - MatE | 40~181 | |
| PF01554 | MatE - MatE | 297~457 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL46 |  |
IC50 | = | 160.0 | nM | 293.37 | Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1=O | Homo sapiens | CHEMBL2320300 | cell-based format |
| CHEMBL941 |  |
IC50 | = | 350.0 | nM | 493.62 | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 | Homo sapiens | CHEMBL2320300 | cell-based format |
| CHEMBL790 |  |
IC50 | = | 500.0 | nM | 505.46 | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1 | Homo sapiens | CHEMBL2320304 | cell-based format |
| CHEMBL58 |  |
IC50 | = | 530.0 | nM | 444.49 | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21 | Homo sapiens | CHEMBL2320300 | cell-based format |