Q6NYC1 | JMJD6_HUMAN | Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 (JMJD6)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF02373 | JmjC | 174–288 |
3D structures mapped by conservation among orthologs
[ Domain: "Double-stranded beta-helix" // JmjC_1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL4443954 | IC50 | = | 220.0 | nM | 277.28 | Cc1ccc2oc(=O)c(-c3nc4cnccc4[nH]3)cc2c1 | Homo sapiens | CHEMBL4316548 | assay format | |
CHEMBL4849961 | IC50 | = | 681.0 | nM | 285.23 | Cn1ccc(-c2cc(C(=O)OCC(F)(F)F)ccn2)n1 | Homo sapiens | CHEMBL4836320 | single protein format | |
CHEMBL4878147 | IC50 | = | 780.0 | nM | 244.25 | Cc1cc(O)nc(NN=Cc2ccccc2O)n1 | Homo sapiens | CHEMBL4836333 | single protein format | |
CHEMBL4869715 | IC50 | = | 914.0 | nM | 231.25 | CCOC(=O)c1ccnc(-c2ccn(C)n2)c1 | Homo sapiens | CHEMBL4836320 | single protein format |