Q16620 | NTRK2_HUMAN | BDNF/NT-3 growth factors receptor (NTRK2)
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF01462 | LRRNT - Leucine rich repeat N-terminal domain | 31~60 | |
PF07679 | I-set - Immunoglobulin I-set domain | 204~283 | |
PF07679 | I-set - Immunoglobulin I-set domain | 306~374 | |
PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 539~806 | |
PF13855 | LRR_8 - Leucine rich repeat | 92~149 | |
PF16920 | LRRCT_2 - Leucine rich repeat C-terminal motif | 151~195 |
3D structures mapped by conservation among orthologs
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // I-set_11 ]
[ Domain: "Protein kinase" // Pkinase_Tyr ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL3286829 | Ki | = | 0.4 | nM | 421.48 | C[C@H]1Oc2cc(cnc2N)-c2c(C3CC3)nn(C)c2CN(C)C(=O)c2ccc(F)cc21 | Homo sapiens | CHEMBL3293393 | single protein format | |
CHEMBL3286820 | Ki | = | 0.5 | nM | 395.44 | Cc1nn(C)c2c1-c1cnc(N)c(c1)O[C@H](C)c1cc(F)ccc1C(=O)N(C)C2 | Homo sapiens | CHEMBL3293393 | single protein format | |
CHEMBL5088153 | Ki | = | 1.0 | nM | 575.07 | Cc1cc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccc(Cl)cc2)ccc1Nc1ncnc2c1OC(C)(C)C(=O)N2 | Homo sapiens | CHEMBL5045136 | single protein format | |
CHEMBL3286830 | Ki | = | 23.0 | nM | 406.42 | C[C@H]1Oc2cc(cnc2N)-c2c(nn(C)c2C#N)CN(C)C(=O)c2ccc(F)cc21 | Homo sapiens | CHEMBL3293393 | single protein format | |
CHEMBL3286832 | Ki | = | 65.0 | nM | 443.44 | C[C@H]1Oc2nc(cnc2N)-c2c(nc3ccc(C#N)cn23)CN(C)C(=O)c2ccc(F)cc21 | Homo sapiens | CHEMBL3293393 | single protein format | |
CHEMBL3286831 | Ki | = | 77.0 | nM | 432.46 | Cc1cnc2nc3c(n2c1)-c1cnc(N)c(c1)O[C@H](C)c1cc(F)ccc1C(=O)N(C)C3 | Homo sapiens | CHEMBL3293393 | single protein format |