Q15569 | TESK1_HUMAN | Dual specificity testis-specific protein kinase 1 (TESK1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 59~311 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 261.0 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328630 | single protein format |
| CHEMBL2070615 |  |
IC50 | = | 455.0 | nM | 461.55 | CCNC(=O)Nc1ncc(-c2cc(-c3c(C)cc(OC)cc3C)nc(-c3cnccn3)n2)s1 | Homo sapiens | CHEMBL2071842 | single protein format |