Q15466 | NR0B2_HUMAN | Nuclear receptor subfamily 0 group B member 2 (NR0B2)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00104 | Hormone_recep - Ligand-binding domain of nuclear hormone receptor | 63~227 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL461415 |  |
IC50 | = | 500.0 | nM | 436.98 | CC12CC3CC(C)(C1)CC(c1cc(-c4ccc(/C=C/C(=O)O)cc4Cl)ccc1O)(C3)C2 | Homo sapiens | CHEMBL968061 | single protein format |
| CHEMBL459497 |  |
IC50 | = | 1000.0 | nM | 410.92 | O=C(O)/C=C/c1ccc(-c2ccc(F)c(C34CC5CC(CC(C5)C3)C4)c2)c(Cl)c1 | Homo sapiens | CHEMBL968061 | single protein format |