Q14643 | ITPR1_HUMAN | Inositol 1,4,5-trisphosphate receptor type 1 (ITPR1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00520 | Ion_trans - Ion transport protein | 2363~2608 | |
| PF01365 | RYDR_ITPR - RIH domain | 474~670 | |
| PF01365 | RYDR_ITPR - RIH domain | 1204~1352 | |
| PF02815 | MIR - MIR domain | 233~432 | |
| PF08454 | RIH_assoc - RyR and IP3R Homology associated | 1971~2077 | |
| PF08709 | Ins145_P3_rec - Inositol 1,4,5-trisphosphate/ryanodine receptor | 5~229 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL279107 |  |
IC50 | = | 300.0 | nM | 420.09 | O=P(O)(O)O[C@@H]1[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O | Homo sapiens | CHEMBL750780 | cell-based format |