Q13564 | ULA1_HUMAN | NEDD8-activating enzyme E1 regulatory subunit (NAE1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00899 | ThiF | 13–531 |
3D structures mapped by conservation among orthologs
[ Domain: "Catalytic cysteine domain in ubiquitin-activating enzyme" // APPBP1_RUB ]
[ Domain: "Activating enzymes of the ubiquitin-like proteins" // ThiF_2,APPBP1_RUB ]
[ Domain: "Activating enzymes of the ubiquitin-like proteins" // ThiF_3 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5177755 | IC50 | = | 0.5 | nM | 572.65 | COC(=O)N1CCC2(CC1)C[C@H](Nc1ncnc3c1nnn3[C@@H]1C[C@@H](COS(N)(=O)=O)[C@@H](O)C1)c1ccccc12 | Homo sapiens | CHEMBL5127981 | single protein format | |
| CHEMBL2322194 | IC50 | = | 4.7 | nM | 445.55 | NS(=O)(=O)OC[C@@H]1C[C@@H](N2CCc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O | Homo sapiens | CHEMBL2328919 | single protein format | |
| CHEMBL2017005 | IC50 | = | 10.0 | nM | 462.49 | NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N[C@H]4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL2328930 | single protein format | |
| CHEMBL1231160 | IC50 | = | 180.0 | nM | 443.53 | NS(=O)(=O)OC[C@@H]1C[C@@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O | Homo sapiens | CHEMBL4733963 | single protein format | |
| CHEMBL4282603 | IC50 | = | 260.0 | nM | 443.53 | NS(=O)(=O)OC[C@@H]1C[C@@H](n2ccc3c(N[C@@H]4CCc5ccccc54)ncnc32)C[C@@H]1O | Homo sapiens | CHEMBL4830933 | single protein format | |
| CHEMBL2322197 | IC50 | = | 800.0 | nM | 374.35 | O=C(O)CNC(=O)CNC(=O)COc1ccc2nc3n(c(=O)c2c1)CCC3 | Homo sapiens | CHEMBL2328914 | single protein format |
