Q13470 | TNK1_HUMAN | Non-receptor tyrosine-protein kinase TNK1 (TNK1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 119~374 | |
| PF22931 | SAM_TNK - SAM domain-like | 10~65 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 0.584 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328636 | single protein format |