Q13418 | ILK_HUMAN | Integrin-linked protein kinase (ILK)
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 194~444 | |
PF12796 | Ank_2 - Ankyrin repeats (3 copies) | 8~63 | |
PF12796 | Ank_2 - Ankyrin repeats (3 copies) | 65~124 |
3D structures mapped by conservation among orthologs
[ Domain: "Ankyrin repeat" // Ank_2 ]
[ Domain: "Protein kinase" // Pkinase_Tyr ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL3681007 | IC50 | = | 7.0 | nM | 327.37 | Cc1[nH]nc(N)c1-c1nc2cc(F)c(S(N)(=O)=O)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3681013 | IC50 | = | 10.0 | nM | 309.38 | Cc1[nH]nc(N)c1-c1nc2ccc(S(N)(=O)=O)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685712 | IC50 | = | 10.0 | nM | 273.37 | NCCCc1[nH]nc(N)c1-c1nc2ccccc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3639798 | IC50 | = | 20.0 | nM | 313.34 | Nc1[nH]ncc1-c1nc2cc(F)c(S(N)(=O)=O)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685727 | IC50 | = | 20.0 | nM | 274.35 | NCCNc1[nH]nc(N)c1-c1nc2ccccc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685682 | IC50 | = | 20.0 | nM | 287.39 | CNCCCc1[nH]nc(N)c1-c1nc2ccccc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3732995 | IC50 | = | 30.0 | nM | 366.43 | CC(=O)NNS(=O)(=O)c1ccc2nc(-c3c(C)n[nH]c3N)sc2c1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3680995 | IC50 | = | 40.0 | nM | 341.39 | CNS(=O)(=O)c1cc2sc(-c3c(N)n[nH]c3C)nc2cc1F | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685652 | IC50 | = | 40.0 | nM | 330.34 | COc1cc2sc(-c3c(-c4ccco4)n[nH]c3N)nc2cc1F | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685661 | IC50 | = | 40.0 | nM | 248.29 | Cc1[nH]nc(N)c1-c1nc2cc(F)ccc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3681027 | IC50 | = | 40.0 | nM | 400.49 | Cc1[nH]nc(N)c1-c1nc2ccc(S(=O)(=O)NCc3ccncc3)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3681005 | IC50 | = | 40.0 | nM | 327.37 | Cc1[nH]nc(N)c1-c1nc2c(F)cc(S(N)(=O)=O)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685631 | IC50 | = | 50.0 | nM | 372.44 | Nc1[nH]nc(-c2ccncc2)c1-c1nc2ccc(S(N)(=O)=O)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3681008 | IC50 | = | 50.0 | nM | 371.42 | Cc1[nH]nc(N)c1-c1nc2cc(F)c(S(=O)(=O)NCCO)cc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685659 | IC50 | = | 50.0 | nM | 248.29 | Cc1cc2sc(-c3cn[nH]c3N)nc2cc1F | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685693 | IC50 | = | 60.0 | nM | 299.4 | Nc1n[nH]c(C2CCNCC2)c1-c1nc2ccccc2s1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3681004 | IC50 | = | 60.0 | nM | 309.38 | CNS(=O)(=O)c1ccc2nc(-c3cn[nH]c3N)sc2c1 | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3680994 | IC50 | = | 60.0 | nM | 306.32 | COC(=O)c1cc2sc(-c3c(N)n[nH]c3C)nc2cc1F | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3685654 | IC50 | = | 60.0 | nM | 278.31 | COc1cc2sc(-c3c(N)n[nH]c3C)nc2cc1F | Homo sapiens | CHEMBL3734121 | cell-based format | |
CHEMBL3680993 | IC50 | = | 70.0 | nM | 363.35 | Cc1[nH]nc(N)c1-c1nc2c(F)c(F)c(F)c(S(N)(=O)=O)c2s1 | Homo sapiens | CHEMBL3734121 | cell-based format |