Q12879 | NMDE1_HUMAN | Glutamate receptor ionotropic, NMDA 2A (GRIN2A)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00060 | Lig_chan - Ligand-gated ion channel | 555~828 | |
| PF01094 | ANF_receptor - Receptor family ligand binding region | 106~280 | |
| PF10565 | NMDAR2_C - N-methyl D-aspartate receptor 2B3 C-terminus | 839~1464 | |
| PF10613 | Lig_chan-Glu_bd - Ligated ion channel L-glutamate- and glycine-binding site | 440~539 |
3D structures mapped by conservation among orthologs
[ Domain: "Voltage-gated ion channels" // Lig_chan ]
[ Domain: "Periplasmic binding protein-like I" // ANF_receptor_3rd ]
[ Domain: "Periplasmic binding protein-like I" // ANF_receptor_2nd ]
[ Domain: "Periplasmic binding protein-like II" // SBP_bac_3_1st ]
[ Domain: "Periplasmic binding protein-like II" // Lig_chan_1 ]
[ Domain: "Periplasmic binding protein-like II" // Lig_chan_5 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4450420 |  |
IC50 | = | 7.9 | nM | 470.94 | Cc1ncc(CNNC(=O)c2cnc(CNS(=O)(=O)c3ccc(F)c(Cl)c3)cn2)s1 | Homo sapiens | CHEMBL4309002 | cell-based format |
| CHEMBL4555447 |  |
IC50 | = | 27.0 | nM | 468.51 | Cc1ncc(CNNC(=O)c2cnc(CNS(=O)(=O)c3ccc(F)c(F)c3)c(C)n2)s1 | Homo sapiens | CHEMBL4309002 | cell-based format |
| CHEMBL2333945 |  |
IC50 | = | 109.0 | nM | 461.9 | O=C(NNC(=O)c1ccc(CNS(=O)(=O)c2ccc(F)c(Cl)c2)cc1)c1ccccc1 | Homo sapiens | CHEMBL4009450 | cell-based format |