P78352 | DLG4_HUMAN | Disks large homolog 4 (DLG4)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00018 | SH3_1 - SH3 domain | 434~490 | |
| PF00595 | PDZ - PDZ domain | 65~149 | |
| PF00595 | PDZ - PDZ domain | 161~243 | |
| PF00595 | PDZ - PDZ domain | 314~388 | |
| PF00625 | Guanylate_kin - Guanylate kinase | 534~710 | |
| PF10600 | PDZ_assoc - PDZ-associated domain of NMDA receptors | 245~312 | |
| PF10608 | MAGUK_N_PEST - Polyubiquitination (PEST) N-terminal domain of MAGUK | 31~64 |
3D structures mapped by conservation among orthologs
[ Domain: "PDZ domain" // PDZ ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1688631 |  |
Ki | = | 630.0 | nM | 544.72 | CC(C)[C@H](NC(=S)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCCC1CCCCC1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1695088 | single protein format |
| CHEMBL1688606 |  |
Ki | = | 750.0 | nM | 572.66 | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCCC1CCCCC1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1695088 | single protein format |
| CHEMBL1688601 |  |
Ki | = | 940.0 | nM | 528.65 | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCCC1CCCCC1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1024689 | assay format |
| CHEMBL2372220 |  |
Ki | = | 980.0 | nM | 558.58 | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCCc1ccc(F)c(F)c1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1024689 | assay format |
| CHEMBL1688637 |  |
Ki | = | 1000.0 | nM | 572.66 | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCCc1ccc2ccccc2c1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1024689 | assay format |
| CHEMBL2372223 |  |
Ki | = | 1000.0 | nM | 514.62 | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NCC1CCCCC1)[C@@H](C)O)C(=O)O | Homo sapiens | CHEMBL1024689 | assay format |