P78325 | ADAM8_HUMAN | Disintegrin and metalloproteinase domain-containing protein 8 (ADAM8)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00200 | Disintegrin | 417–489 | |
PF01421 | Reprolysin | 200–400 | |
PF01562 | Pep_M12B_propep | 30–112 | |
PF08516 | ADAM_CR | 494–559 |
3D structures mapped by conservation among orthologs
[ Domain: "Metalloproteases ("zincins") catalytic domain" // Reprolysin ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL2431028 | IC50 | = | 12.0 | nM | 594.28 | NC(=O)NCCC[C@@H](NS(=O)(=O)c1ccc(OCc2cc(Br)cc(Br)c2)cc1)C(=O)NO | Homo sapiens | CHEMBL5229257 | single protein format | |
CHEMBL434567 | IC50 | = | 1000.0 | nM | 413.47 | COC(=O)N1CC2(CC2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CC=C(c2ccccc2)CC1 | Homo sapiens | CHEMBL953089 | single protein format |