P57764 | GSDMD_HUMAN | Gasdermin-D (GSDMD)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF04598 | Gasdermin | 4–242 | |
| PF17708 | Gasdermin_C | 286–456 |
3D structures mapped by conservation among orthologs
[ Domain: "Membrane attack complex/perforin (MACPF) and cholesterol-dependent cytolysin (CDC) domains" // Gasdermin_N ]
[ Domain: "PUB domain" // Gasdermin_C ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL964 |  |
IC50 | = | 400.0 | nM | 296.55 | CCN(CC)C(=S)SSC(=S)N(CC)CC | Homo sapiens | CHEMBL4321889 | single protein format |
| CHEMBL961 |  |
IC50 | = | 400.0 | nM | 149.28 | CCN(CC)C(=S)S | Homo sapiens | CHEMBL4321889 | single protein format |