P54136 | SYRC_HUMAN | Arginine--tRNA ligase, cytoplasmic (RARS1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00750 | tRNA-synt_1d | 174–520 | |
| PF03485 | Arg_tRNA_synt_N | 79–166 | |
| PF05746 | DALR_1 | 534–660 |
3D structures mapped by conservation among orthologs
[ Domain: "Anticodon-binding domain of a subclass of class I aminoacyl-tRNA synthetases" // DALR_1,tRNA-synt_1d ]
[ Domain: "Arginyl-tRNA synthetase (ArgRS), N-terminal 'additional' domain" // Arg_tRNA_synt_N ]
[ Domain: "HUP domains" // tRNA-synt_1d ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1160244 | IC50 | = | 4.5 | nM | 502.51 | N=C(N)NCCC[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL645582 | single protein format | |
| CHEMBL434782 | IC50 | = | 7.5 | nM | 489.43 | N=C(N)NCCC[C@H](N)COP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL645582 | single protein format |
