P54132 | BLM_HUMAN | Bloom syndrome protein (BLM)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00270 | DEAD - DEAD/DEAH box helicase | 670~839 | |
| PF00271 | Helicase_C - Helicase conserved C-terminal domain | 882~984 | |
| PF00570 | HRDC - HRDC domain | 1217~1281 | |
| PF08072 | BDHCT - BDHCT (NUC031) domain | 372~412 | |
| PF09382 | RQC - RQC domain | 1072~1195 | |
| PF16124 | RecQ_Zn_bind - RecQ zinc-binding | 995~1067 | |
| PF16202 | BLM_N - N-terminal region of Bloom syndrome protein | 1~368 | |
| PF16204 | BDHCT_assoc - BDHCT-box associated domain on Bloom syndrome protein | 425~647 |
3D structures mapped by conservation among orthologs
[ Domain: "winged" // RQC ]
[ Domain: "SAM domain-like" // HRDC ]
[ Domain: "P-loop containing nucleoside triphosphate hydrolases" // DEAD ]
[ Domain: "P-loop containing nucleoside triphosphate hydrolases" // Helicase_C_1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL2426190 |  |
IC50 | = | 100.0 | nM | 356.8 | N#Cc1cc(NC(=O)Nc2nnc(-c3ccncc3)s2)ccc1Cl | Homo sapiens | CHEMBL2428261 | single protein format |
| CHEMBL2426164 |  |
IC50 | = | 110.0 | nM | 401.25 | N#Cc1cc(NC(=O)Nc2nnc(-c3ccncc3)s2)ccc1Br | Homo sapiens | CHEMBL2428261 | single protein format |
| CHEMBL2426169 |  |
IC50 | = | 300.0 | nM | 340.34 | N#Cc1cc(NC(=O)Nc2nnc(-c3ccncc3)s2)ccc1F | Homo sapiens | CHEMBL2428261 | single protein format |
| CHEMBL4633662 |  |
IC50 | = | 800.0 | nM | 499.07 | CCN(CC)CCCNc1cc2nc(/C=C/c3ccc(C(C)C)cc3)n(CCCl)c(=O)c2cc1F | Homo sapiens | CHEMBL4625931 | cell-based format |
| CHEMBL2426165 |  |
IC50 | = | 910.0 | nM | 401.25 | N#Cc1ccc(NC(=O)Nc2nnc(-c3ccncc3)s2)cc1Br | Homo sapiens | CHEMBL2428261 | single protein format |
| CHEMBL4075790 |  |
IC50 | = | 950.0 | nM | 462.61 | CCN(CC)CCCNc1cc2nc3n(c(=O)c2cc1F)CC/C3=C\c1ccc(C(C)C)cc1 | Homo sapiens | CHEMBL4320955 | assay format |