P51692 | STA5B_HUMAN | Signal transducer and activator of transcription 5B (STAT5B)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00017 | SH2 - SH2 domain | 595~668 | |
| PF01017 | STAT_alpha - STAT transcription factor, coiled-coil domain | 146~324 | |
| PF02864 | STAT_bind - STAT protein, DNA binding domain | 336~469 | |
| PF02865 | STAT_int - STAT protein, protein interaction domain | 2~123 | |
| PF21354 | STAT_linker - Signal transducer and activator of transcription, linker domain | 492~574 |
3D structures mapped by conservation among orthologs
[ Domain: "Common fold of diphtheria toxin/transcription factors/cytochrome f" // STAT_bind_N ]
[ Domain: "EF-hand" // STAT_bind_C ]
[ Domain: "STAT" // STAT_alpha ]
[ Domain: "SH2" // SH2 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4066274 |  |
IC50 | = | 280.0 | nM | 552.37 | O=C(COc1ccc(C(=O)Nc2ccccc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | Homo sapiens | CHEMBL4055339 | single protein format |
| CHEMBL4077592 |  |
IC50 | = | 330.0 | nM | 586.81 | O=C(COc1ccc(C(=O)Nc2ccc(Cl)cc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | Homo sapiens | CHEMBL4055339 | single protein format |
| CHEMBL4093849 |  |
IC50 | = | 350.0 | nM | 570.36 | O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | Homo sapiens | CHEMBL4055339 | single protein format |
| CHEMBL4075745 |  |
IC50 | = | 460.0 | nM | 586.81 | O=C(COc1ccc(C(=O)Nc2cccc(Cl)c2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | Homo sapiens | CHEMBL4055339 | single protein format |
| CHEMBL4062751 |  |
IC50 | = | 620.0 | nM | 570.36 | O=C(COc1ccc(C(=O)Nc2cccc(F)c2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | Homo sapiens | CHEMBL4055339 | single protein format |
| CHEMBL4549938 |  |
Ki | = | 600.0 | nM | 305.23 | O=C(O)c1nonc1NCn1nnnc1-c1ccc(F)cc1 | Homo sapiens | CHEMBL4357304 | single protein format |