P48065 | S6A12_HUMAN | Sodium- and chloride-dependent betaine transporter (SLC6A12)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00209 | SNF - Sodium:neurotransmitter symporter family | 36~560 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3326391 |  |
IC50 | = | 590.0 | nM | 141.17 | N[C@@]12CC[C@H](C(=O)O)[C@@H]1C2 | Homo sapiens | CHEMBL3363499 | cell-based format |
| CHEMBL96 |  |
IC50 | = | 1000.0 | nM | 103.12 | NCCCC(=O)O | Homo sapiens | CHEMBL4031713 | cell-based format |