P48065 | S6A12_HUMAN | Sodium- and chloride-dependent betaine transporter (SLC6A12)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00209 | SNF | 36–560 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL3326391 | IC50 | = | 590.0 | nM | 141.17 | N[C@@]12CC[C@H](C(=O)O)[C@@H]1C2 | Homo sapiens | CHEMBL3363499 | cell-based format | |
CHEMBL96 | IC50 | = | 1000.0 | nM | 103.12 | NCCCC(=O)O | Homo sapiens | CHEMBL4031713 | cell-based format |