P42356 | PI4KA_HUMAN | Phosphatidylinositol 4-kinase alpha (PI4KA)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00454 | PI3_PI4_kinase - Phosphatidylinositol 3- and 4-kinase | 1845~2050 | |
| PF00613 | PI3Ka - Phosphoinositide 3-kinase family, accessory domain (PIK domain) | 1583~1726 | |
| PF19274 | PI4K_N - PI4-kinase N-terminal region | 378~1514 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4161766 |  |
IC50 | = | 130.6 | nM | 494.04 | Cc1ccccc1S(=O)(=O)Nc1cc(-c2sc(NC(=O)[C@@H](N)C(C)C)nc2C)cnc1Cl | Homo sapiens | CHEMBL4156830 | single protein format |
| CHEMBL4164334 |  |
IC50 | = | 163.7 | nM | 494.04 | Cc1ccc(S(=O)(=O)Nc2cc(-c3sc(NC(=O)[C@@H](N)C(C)C)nc3C)cnc2Cl)cc1 | Homo sapiens | CHEMBL4156830 | single protein format |
| CHEMBL428496 |  |
IC50 | = | 280.0 | nM | 428.44 | COC[C@H]1OC(=O)c2coc3c2[C@@]1(C)C1=C(C3=O)[C@@H]2CCC(=O)[C@@]2(C)C[C@H]1OC(C)=O | Homo sapiens | CHEMBL5217090 | single protein format |
| CHEMBL3901551 |  |
IC50 | = | 450.0 | nM | 486.0 | CC(C)(C)OC(=O)CCNC(=O)Nc1nc2c(s1)-c1nc(-c3ccccc3Cl)ncc1CC2 | Homo sapiens | CHEMBL3864064 | cell-based format |
| CHEMBL3947384 |  |
IC50 | = | 553.0 | nM | 584.15 | CCc1cc(CNc2cc(Cl)nn3c(-c4ccc(OC)c(S(=O)(=O)NC5CCC(N)CC5)c4)c(C)nc23)ccn1 | Homo sapiens | CHEMBL3864068 | single protein format |
| CHEMBL4174988 |  |
IC50 | = | 574.1 | nM | 494.04 | Cc1cccc(S(=O)(=O)Nc2cc(-c3sc(NC(=O)[C@@H](N)C(C)C)nc3C)cnc2Cl)c1 | Homo sapiens | CHEMBL4156830 | single protein format |
| CHEMBL3986552 |  |
IC50 | = | 660.0 | nM | 550.09 | COc1ccc(-c2c(C)nc3c(NCCNC(C)=O)cc(Cl)nn23)cc1S(=O)(=O)NC1CCC(N)CC1 | Homo sapiens | CHEMBL3864068 | single protein format |