P42229 | STA5A_HUMAN | Signal transducer and activator of transcription 5A (STAT5A)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00017 | SH2 | 595–669 | |
| PF01017 | STAT_alpha | 146–324 | |
| PF02864 | STAT_bind | 336–469 | |
| PF02865 | STAT_int | 3–123 | |
| PF21354 | STAT_linker | 492–574 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL574058 | IC50 | = | 5.0 | nM | 429.28 | Cc1cc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)ccc1F | Homo sapiens | CHEMBL3225223 | cell-based format | |
| CHEMBL603469 | IC50 | = | 10.0 | nM | 439.47 | C[C@]12O[C@H](C[C@]1(O)CO)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)CNC4=O | Homo sapiens | CHEMBL5347064 | cell-based format | |
| CHEMBL1231124 | IC50 | = | 41.0 | nM | 348.77 | Cc1cc(Nc2nc(N[C@@H](C)c3ncc(F)cn3)ncc2Cl)[nH]n1 | Homo sapiens | CHEMBL1656964 | cell-based format | |
| CHEMBL559787 | IC50 | = | 689.0 | nM | 397.43 | O=C1NCc2c1c1c3ccccc3n3c1c1c2c2ccccc2n1C[C@@H](O)[C@@H](O)C3 | Homo sapiens | CHEMBL1053845 | cell-based format |
