P42224 | STAT1_HUMAN | Signal transducer and activator of transcription 1-alpha/beta (STAT1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00017 | SH2 | 578–622 | |
| PF01017 | STAT_alpha | 144–308 | |
| PF02864 | STAT_bind | 322–458 | |
| PF02865 | STAT_int | 2–119 | |
| PF12162 | STAT1_TAZ2bind | 715–738 | |
| PF21354 | STAT_linker | 481–558 |
3D structures mapped by conservation among orthologs
[ Domain: "Common fold of diphtheria toxin/transcription factors/cytochrome f" // STAT_bind_N ]
[ Domain: "EF-hand" // STAT_bind_C ]
[ Domain: "Transcription factor STAT-4 N-domain" // STAT_int ]
[ Domain: "STAT" // STAT_alpha ]
[ Domain: "SH2" // SH2 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4864495 | IC50 | = | 350.0 | nM | 577.77 | CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)c(OC)c1C | Homo sapiens | CHEMBL4816238 | cell-based format | |
| CHEMBL4846078 | IC50 | = | 880.0 | nM | 242.23 | CC(=O)C1=CC2C(=O)c3ccccc3C(=O)C2O1 | Homo sapiens | CHEMBL4816238 | cell-based format |
