P41252 | SYIC_HUMAN | Isoleucine--tRNA ligase, cytoplasmic (IARS1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00133 | tRNA-synt_1 - tRNA synthetases class I (I, L, M and V) | 17~638 | |
| PF08264 | Anticodon_1 - Anticodon-binding domain of tRNA ligase | 693~849 | |
| PF19302 | DUF5915 - Domain of unknown function (DUF5915) | 868~1036 | |
| PF23567 | Ubiquitin_IARS1 - Isoleucine--tRNA ligase, cytoplasmic, ubiquitin-like | 1077~1160 | |
| PF23567 | Ubiquitin_IARS1 - Isoleucine--tRNA ligase, cytoplasmic, ubiquitin-like | 1169~1259 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL719 |  |
IC50 | = | 0.8 | nM | 500.63 | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O | Homo sapiens | CHEMBL696842 | single protein format |
| CHEMBL605376 |  |
IC50 | = | 14.0 | nM | 585.38 | CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1OC(n2cnc3c(N)nc(I)nc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696843 | single protein format |
| CHEMBL125075 |  |
IC50 | = | 15.0 | nM | 515.61 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3cccc(OC)c3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL340359 |  |
IC50 | = | 20.0 | nM | 565.67 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccc4cc(OC)ccc4c3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL538163 |  |
IC50 | = | 30.0 | nM | 515.61 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccccc3OC)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL125820 |  |
IC50 | = | 30.0 | nM | 513.64 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(CCc3ccccc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL605592 |  |
IC50 | = | 39.0 | nM | 483.51 | C#Cc1nc(N)c2ncn(C3O[C@H](COS(=O)(=O)NC(=O)[C@@H](N)[C@@H](C)CC)[C@@H](O)[C@H]3O)c2n1 | Homo sapiens | CHEMBL696843 | single protein format |
| CHEMBL125221 |  |
IC50 | = | 45.0 | nM | 577.68 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccc(Oc4ccccc4)cc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL1163069 |  |
IC50 | = | 98.0 | nM | 459.49 | CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696843 | single protein format |
| CHEMBL333001 |  |
IC50 | = | 100.0 | nM | 515.61 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccc(OC)cc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL264002 |  |
IC50 | = | 100.0 | nM | 485.58 | CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3ccccc3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL94318 |  |
IC50 | = | 100.0 | nM | 528.06 | COC(=O)CCCCCCCCOC(=O)/C=C/C[C@@H]1OC[C@H](NS(=O)(=O)CCCCl)[C@@H](O)[C@H]1O | Homo sapiens | CHEMBL696842 | single protein format |
| CHEMBL123796 |  |
IC50 | = | 120.0 | nM | 500.56 | CCC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](c2nc(-c3cc(C#N)co3)cs2)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696841 | single protein format |
| CHEMBL95037 |  |
IC50 | = | 300.0 | nM | 507.65 | CCCCS(=O)(=O)N[C@H]1CO[C@@H](C/C=C/C(=O)OCCCCCCCCC(=O)OC)[C@H](O)[C@@H]1O | Homo sapiens | CHEMBL696842 | single protein format |
| CHEMBL98732 |  |
IC50 | = | 300.0 | nM | 562.08 | COC(=O)CCCCCCCCOC(=O)/C=C/C[C@@H]1OC[C@H](NS(=O)(=O)c2cccc(Cl)c2)[C@@H](O)[C@H]1O | Homo sapiens | CHEMBL696842 | single protein format |