P35590 | TIE1_HUMAN | Tyrosine-protein kinase receptor Tie-1 (TIE1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00041 | fn3 - Fibronectin type III domain | 458~535 | |
| PF00041 | fn3 - Fibronectin type III domain | 558~635 | |
| PF00041 | fn3 - Fibronectin type III domain | 646~733 | |
| PF00047 | ig - Immunoglobulin domain | 133~206 | |
| PF00047 | ig - Immunoglobulin domain | 359~439 | |
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 839~1106 |
3D structures mapped by conservation among orthologs
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // fn3 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3907057 |  |
IC50 | = | 5.4 | nM | 558.54 | Cc1cc(C)c(-n2ccn3nc(-c4cccnc4)cc23)cc1NC(=O)c1cc(C#N)cc(S(F)(F)(F)(F)F)c1 | Homo sapiens | CHEMBL5210178 | assay format |
| CHEMBL4526351 |  |
IC50 | = | 130.0 | nM | 519.5 | Cc1cc(NC(=O)c2cccc(S(F)(F)(F)(F)F)c2)cc(-n2ccn3nc(-c4cccnc4)cc23)c1 | Homo sapiens | CHEMBL5210160 | assay format |
| CHEMBL103667 |  |
IC50 | < | 1000.0 | nM | 527.67 | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)cc1 | Homo sapiens | CHEMBL4602934 | single protein format |