P32298 | GRK4_HUMAN | G protein-coupled receptor kinase 4 (GRK4)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00069 | Pkinase | 189–448 | |
PF00615 | RGS | 53–171 |
3D structures mapped by conservation among orthologs
[ Domain: "Regulator of G-protein signaling, RGS" // RGS ]
[ Domain: "Protein kinase" // Pkinase_Tyr ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL4877302 | IC50 | = | 22.0 | nM | 438.92 | CCc1cc(Nc2nc(NCc3ccc(Cl)cc3OC)nc3cccc(OC)c23)n[nH]1 | Homo sapiens | CHEMBL4810442 | single protein format | |
CHEMBL4854871 | IC50 | = | 97.0 | nM | 407.45 | CCc1cc(Nc2nc(N[C@@H](C)c3ccc(F)cn3)nc3cccc(OC)c23)n[nH]1 | Homo sapiens | CHEMBL4810442 | single protein format | |
CHEMBL388978 | IC50 | = | 113.0 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328435 | single protein format | |
CHEMBL4847703 | IC50 | = | 190.0 | nM | 393.43 | CCc1cc(Nc2nc(NCc3ccc(F)cn3)nc3cccc(OC)c23)n[nH]1 | Homo sapiens | CHEMBL4810442 | single protein format | |
CHEMBL60254 | IC50 | = | 260.0 | nM | 550.52 | O=C(N[C@@H]1CNCCC[C@H]1OC(=O)c1cc(O)c(C(=O)c2c(O)cccc2C(=O)O)c(O)c1)c1ccc(O)cc1 | Homo sapiens | CHEMBL1106958 | single protein format | |
CHEMBL4568087 | IC50 | = | 260.0 | nM | 421.53 | Cn1cc(-c2cnc3c(-c4csc(C(=O)N[C@@H]5CCCC[C@@H]5N)c4)cnn3c2)cn1 | Homo sapiens | CHEMBL4479722 | assay format | |
CHEMBL4552628 | IC50 | = | 670.0 | nM | 425.89 | Cc1sc(C(=O)N[C@@H]2[C@H](N)CCCC2(F)F)cc1-c1cnn2cc(Cl)cnc12 | Homo sapiens | CHEMBL4479722 | assay format |