P27708 | PYR1_HUMAN | CAD protein (CAD)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00117 | GATase | 180–355 | |
| PF00185 | OTCace | 2072–2220 | |
| PF00988 | CPSase_sm_chain | 4–137 | |
| PF01979 | Amidohydro_1 | 1464–1522 | |
| PF02142 | MGS | 1327–1427 | |
| PF02729 | OTCace_N | 1924–2065 | |
| PF02786 | CPSase_L_D2 | 514–717 | |
| PF02786 | CPSase_L_D2 | 1050–1247 | |
| PF02787 | CPSase_L_D3 | 801–877 | |
| PF25596 | CPSase_L_D1 | 394–510 | |
| PF25596 | CPSase_L_D1 | 933–1043 |
3D structures mapped by conservation among orthologs
[ Domain: "Composite domain of metallo-dependent hydrolases" // D-HYD_C ]
[ Domain: "TIM barrels" // DHOase ]
[ Domain: "Aspartate/ornithine carbamoyltransferase" // OTCace ]
[ Domain: "Aspartate/ornithine carbamoyltransferase" // OTCace_N ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL170214 |  |
Ki | = | 140.0 | nM | 188.21 | O=C1N=C(CS)CC(C(=O)O)N1 | Homo sapiens | CHEMBL663682 | single protein format |
| CHEMBL29908 |  |
Ki | = | 140.0 | nM | 190.22 | O=C1N[C@@H](CS)C[C@@H](C(=O)O)N1 | Homo sapiens | CHEMBL876720 | assay format |