P26640 | SYVC_HUMAN | Valine--tRNA ligase (VARS1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00043 | GST_C - Glutathione S-transferase, C-terminal domain | 109~198 | |
| PF00133 | tRNA-synt_1 - tRNA synthetases class I (I, L, M and V) | 309~939 | |
| PF08264 | Anticodon_1 - Anticodon-binding domain of tRNA ligase | 984~1132 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL74755 |  |
IC50 | = | 30.0 | nM | 475.52 | CC(C)[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1(C(=O)O)[C@@H]2CN(C)C=C(C(N)=O)[C@@H]2C[C@@H]1O | Homo sapiens | CHEMBL816240 | single protein format |
| CHEMBL74395 |  |
IC50 | = | 126.0 | nM | 489.55 | CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1(C(=O)O)[C@@H]2CN(C)C=C(C(N)=O)[C@@H]2C[C@@H]1O | Homo sapiens | CHEMBL816240 | single protein format |
| CHEMBL421500 |  |
IC50 | = | 290.0 | nM | 489.55 | CC(C)C[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1(C(=O)O)[C@@H]2CN(C)C=C(C(N)=O)[C@@H]2C[C@@H]1O | Homo sapiens | CHEMBL816240 | single protein format |