P22314 | UBA1_HUMAN | Ubiquitin-like modifier-activating enzyme 1 (UBA1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00899 | ThiF | 55–416 | |
| PF00899 | ThiF | 451–637 | |
| PF00899 | ThiF | 885–945 | |
| PF09358 | E1_UFD | 955–1053 | |
| PF10585 | UBA_E1_SCCH | 638–884 | |
| PF16190 | E1_FCCH | 227–296 | |
| PF16191 | E1_4HB | 297–366 |
3D structures mapped by conservation among orthologs
[ Domain: "Alanine racemase-C" // E1_FCCH ]
[ Domain: "E2-binding domain of E1" // E1_UFD ]
[ Domain: "Activating enzymes of the ubiquitin-like proteins" // ThiF_1 ]
[ Domain: "Activating enzymes of the ubiquitin-like proteins" // ThiF_3 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL5177755 |  |
IC50 | = | 66.0 | nM | 572.65 | COC(=O)N1CCC2(CC1)C[C@H](Nc1ncnc3c1nnn3[C@@H]1C[C@@H](COS(N)(=O)=O)[C@@H](O)C1)c1ccccc12 | Homo sapiens | CHEMBL5127982 | single protein format |
| CHEMBL5175806 |  |
IC50 | = | 449.0 | nM | 506.52 | CCOc1cccc(F)c1C#Cc1cn([C@@H]2O[C@H](CNS(N)(=O)=O)[C@@H](O)[C@H]2O)c2ncnc(N)c12 | Homo sapiens | CHEMBL5127976 | assay format |