P20393 | NR1D1_HUMAN | Nuclear receptor subfamily 1 group D member 1 (NR1D1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00104 | Hormone_recep - Ligand-binding domain of nuclear hormone receptor | 437~611 | |
| PF00105 | zf-C4 - Double treble clef zinc finger, C4 type | 131~200 |
3D structures mapped by conservation among orthologs
[ Domain: "Nuclear receptor ligand-binding domain" // Hormone_recep_1 ]
[ Domain: "LIM domain-like" // zf-C4 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1961796 |  |
IC50 | = | 670.0 | nM | 437.95 | CCOC(=O)N1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc([N+](=O)[O-])s2)C1 | Homo sapiens | CHEMBL1961798 | cell-based format |
| CHEMBL1961797 |  |
IC50 | = | 790.0 | nM | 479.05 | CCCCCNC(=O)N1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc([N+](=O)[O-])s2)C1 | Homo sapiens | CHEMBL1961798 | cell-based format |