P16066 | ANPRA_HUMAN | Atrial natriuretic peptide receptor 1 (NPR1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00211 | Guanylate_cyc - Adenylate and Guanylate cyclase catalytic domain | 867~1052 | |
| PF01094 | ANF_receptor - Receptor family ligand binding region | 55~415 | |
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 555~799 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL507122 |  |
IC50 | = | 36.0 | nM | 269.05 | O=c1onc2n1-c1cc(Br)ccc1OC2 | Homo sapiens | CHEMBL984784 | single protein format |
| CHEMBL5440517 |  |
IC50 | = | 850.0 | nM | 571.63 | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)CCC(=O)N[C@@H](CCCNC(=N)N)C(=O)O | Homo sapiens | CHEMBL5379507 | cell-based format |