P15313 | VATB1_HUMAN | V-type proton ATPase subunit B, kidney isoform (ATP6V1B1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00006 | ATP-synt_ab - ATP synthase alpha/beta family, nucleotide-binding domain | 167~393 | |
| PF02874 | ATP-synt_ab_N - ATP synthase alpha/beta family, beta-barrel domain | 44~110 | |
| PF22919 | ATP-synt_VA_C - C-terminal domain of V and A type ATP synthase | 399~498 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL291117 |  |
IC50 | = | 100.0 | nM | 257.29 | COC(=O)/C(=C\C=C\c1cc2ccccc2[nH]1)OC | Homo sapiens | CHEMBL813071 | assay format |
| CHEMBL41588 |  |
IC50 | = | 370.0 | nM | 515.45 | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCN1CCN(c2ncccn2)CC1 | Homo sapiens | CHEMBL813071 | assay format |
| CHEMBL449696 |  |
IC50 | = | 440.0 | nM | 450.41 | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NC1CC(C)(C)NC(C)(C)C1 | Homo sapiens | CHEMBL813071 | assay format |