P14616 | INSRR_HUMAN | Insulin receptor-related protein (INSRR)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00041 | fn3 - Fibronectin type III domain | 820~905 | |
| PF00757 | Furin-like - Furin-like cysteine rich region | 174~329 | |
| PF01030 | Recep_L_domain - Receptor L domain | 47~157 | |
| PF01030 | Recep_L_domain - Receptor L domain | 346~454 | |
| PF07714 | PK_Tyr_Ser-Thr - Protein tyrosine and serine/threonine kinase | 980~1245 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL388978 |  |
IC50 | = | 15.0 | nM | 466.54 | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 | Homo sapiens | CHEMBL4328456 | single protein format |
| CHEMBL1091644 |  |
IC50 | = | 75.0 | nM | 421.5 | C[C@]1(O)C[C@@H](c2nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c3c(N)nccn32)C1 | Homo sapiens | CHEMBL5210320 | single protein format |